31185-78-1 Usage
Explanation
This is the commonly used name for 2-[(2-AMINO-4-PYRIMIDINYL)AMINO]BENZOIC ACID, making it easier to refer to the compound in conversations and research.
Explanation
The molecular formula represents the number of carbon (C), hydrogen (H), nitrogen (N), and oxygen (O) atoms in the compound, which is essential for understanding its structure and properties.
3. Derivative of benzoic acid
Explanation
2-[(2-AMINO-4-PYRIMIDINYL)AMINO]BENZOIC ACID is derived from benzoic acid, which provides insight into its chemical structure and potential applications.
4. Contains a pyrimidine ring
Explanation
The presence of a pyrimidine ring in the compound indicates its chemical structure and suggests potential applications in various fields, including pharmaceuticals and materials science.
5. Use in sunscreen products
Explanation
Aminobenzoic acid is commonly used in the manufacturing of sunscreen products due to its ability to absorb ultraviolet (UV) radiation, providing protection against sunburn and skin damage.
6. Medicinal applications
Explanation
Aminobenzoic acid is used as a medication to treat certain skin conditions, such as psoriasis and eczema, due to its anti-inflammatory properties.
7. Inclusion in dietary supplements
Explanation
Aminobenzoic acid is sometimes included in dietary supplements for its potential health benefits, including promoting skin health and providing antioxidant properties.
8. Use in topical creams and ointments
Explanation
The anti-inflammatory properties of aminobenzoic acid make it a useful ingredient in topical creams and ointments for treating skin conditions and providing relief from inflammation and irritation.
9. Potential applications in organic chemistry and pharmaceutical research
Explanation
Aminobenzoic acid has potential applications in the fields of organic chemistry and pharmaceutical research due to its unique structure and properties, which may lead to the development of new compounds and therapies.
Check Digit Verification of cas no
The CAS Registry Mumber 31185-78-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,1,1,8 and 5 respectively; the second part has 2 digits, 7 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 31185-78:
(7*3)+(6*1)+(5*1)+(4*8)+(3*5)+(2*7)+(1*8)=101
101 % 10 = 1
So 31185-78-1 is a valid CAS Registry Number.
InChI:InChI=1/C11H10N4O2/c12-11-13-6-5-9(15-11)14-8-4-2-1-3-7(8)10(16)17/h1-6H,(H,16,17)(H3,12,13,14,15)
