31489-08-4 Usage
Description
Pyridosine, also known as Amino-5-hydroxy-2-methyl-4-oxo-pyridine hexanoic acid, is a chemical compound that has been utilized in various analytical studies due to its unique properties and potential applications across different industries.
Uses
Used in Analytical Chemistry:
Pyridosine is used as a reagent in analytical chemistry for its ability to interact with various compounds and facilitate specific chemical reactions. Its use in this field aids in the identification, separation, and quantification of different substances.
Used in Pharmaceutical Research:
In the pharmaceutical industry, Pyridosine is used as a key compound in the development of new drugs. Its unique structure allows it to be a building block for the synthesis of various pharmaceutical agents, contributing to the advancement of medicinal chemistry.
Used in Environmental Studies:
Pyridosine is also utilized in environmental studies, where it can be employed to analyze and monitor the presence of specific contaminants or pollutants in the environment. This application helps in assessing the impact of human activities on ecosystems and developing strategies for environmental protection.
Used in Material Science:
In the field of material science, Pyridosine can be used to develop new materials with specific properties. Its chemical structure can be manipulated to create compounds with tailored characteristics, such as improved strength, flexibility, or conductivity, which can be applied in various technological applications.
Check Digit Verification of cas no
The CAS Registry Mumber 31489-08-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,1,4,8 and 9 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 31489-08:
(7*3)+(6*1)+(5*4)+(4*8)+(3*9)+(2*0)+(1*8)=114
114 % 10 = 4
So 31489-08-4 is a valid CAS Registry Number.
InChI:InChI=1/C12H18N2O4/c1-8-6-10(15)11(16)7-14(8)5-3-2-4-9(13)12(17)18/h6-7,9,16H,2-5,13H2,1H3,(H,17,18)/t9-/m0/s1
