3201-98-7 Usage
General Description
α-Benzyl-N-methylfuran-2-methanamine is a chemical compound with a complex structure and a variety of potential applications. It belongs to the class of furan derivatives and contains a benzyl group, a methyl group, and an amino group attached to a furan ring. α-Benzyl-N-methylfuran-2-methanamine may have pharmaceutical potential due to its structural features, as furan derivatives have been studied for their pharmacological properties. Additionally, it may also be used in the field of organic synthesis as a building block for the creation of more complex molecular structures. Overall, α-Benzyl-N-methylfuran-2-methanamine has the potential for diverse practical applications and further investigation is needed to fully understand its properties and potential uses.
Check Digit Verification of cas no
The CAS Registry Mumber 3201-98-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,2,0 and 1 respectively; the second part has 2 digits, 9 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 3201-98:
(6*3)+(5*2)+(4*0)+(3*1)+(2*9)+(1*8)=57
57 % 10 = 7
So 3201-98-7 is a valid CAS Registry Number.
InChI:InChI=1/C13H15NO/c1-14-12(13-8-5-9-15-13)10-11-6-3-2-4-7-11/h2-9,12,14H,10H2,1H3