32048-19-4 Usage
General Description
2,4-DIMETHOXY-BENZAMIDINE is a chemical compound with the molecular formula C9H12N2O2. It is a benzamidine derivative with two methoxy groups attached to the benzene ring. 2,4-DIMETHOXY-BENZAMIDINE is commonly used in organic synthesis as a reagent for the preparation of various pharmaceuticals and organic compounds. It is also used as a building block for the synthesis of heterocyclic compounds and other complex organic molecules. Additionally, 2,4-DIMETHOXY-BENZAMIDINE has been investigated for its potential biological activities, including its ability to inhibit certain enzymes and its potential as a drug candidate for various diseases. Overall, 2,4-DIMETHOXY-BENZAMIDINE is a versatile and important compound in organic chemistry and pharmaceutical research.
Check Digit Verification of cas no
The CAS Registry Mumber 32048-19-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,2,0,4 and 8 respectively; the second part has 2 digits, 1 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 32048-19:
(7*3)+(6*2)+(5*0)+(4*4)+(3*8)+(2*1)+(1*9)=84
84 % 10 = 4
So 32048-19-4 is a valid CAS Registry Number.
InChI:InChI=1/C9H12N2O2/c1-12-6-3-4-7(9(10)11)8(5-6)13-2/h3-5H,1-2H3,(H3,10,11)