32150-73-5 Usage
Explanation
The molecular formula represents the number of atoms of each element present in a molecule. In this case, the compound has 17 carbon (C), 19 hydrogen (H), 3 nitrogen (N), and 2 oxygen (O) atoms.
Explanation
The compound is based on a pyrimidine ring, which is a six-membered heterocyclic aromatic ring containing four carbon atoms and two nitrogen atoms.
Explanation
A pyrrolidinyl group, which is a five-membered ring containing one nitrogen atom, is attached to the 5th carbon of the pyrimidine ring.
Phenyl group at the 3rd carbon
Explanation
A phenyl group, which is a six-membered aromatic ring containing six carbon atoms, is attached to the 3rd carbon of the pyrimidine ring.
Two methyl groups at the 1st and 6th carbons
Explanation
Two methyl groups (-CH3) are attached to the 1st and 6th carbons of the pyrimidine ring, making the compound dimethylated.
4. Potential pharmaceutical applications
Explanation
Due to its unique structure and potential biological activity, the compound may have applications in the pharmaceutical industry. However, further research is required to determine its specific properties and potential uses.
Explanation
The compound's specific properties, potential uses, and biological activity are not yet fully understood, and additional research is necessary to explore these aspects.
Chemical structure
Pyrimidine-based compound
Substituents
1-Pyrrolidinyl group at the 5th carbon
Research status
Further research needed
Check Digit Verification of cas no
The CAS Registry Mumber 32150-73-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,2,1,5 and 0 respectively; the second part has 2 digits, 7 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 32150-73:
(7*3)+(6*2)+(5*1)+(4*5)+(3*0)+(2*7)+(1*3)=75
75 % 10 = 5
So 32150-73-5 is a valid CAS Registry Number.
InChI:InChI=1/C16H19N3O2/c1-12-14(18-10-6-7-11-18)15(20)19(16(21)17(12)2)13-8-4-3-5-9-13/h3-5,8-9H,6-7,10-11H2,1-2H3
