32265-82-0 Usage
General Description
4-Bromo-2,6-dimethylphenyl isothiocyanate is a chemical compound with the molecular formula C10H9BrNS. It is a synthetic derivative of isothiocyanate, commonly used in organic synthesis and pharmaceutical research. 4-BROMO-2,6-DIMETHYLPHENYL ISOTHIOCYANATE has a phenyl ring with bromine and methyl groups attached, as well as an isothiocyanate functional group. It is known for its reactivity towards nucleophiles, making it useful in the synthesis of various organic compounds. Additionally, 4-bromo-2,6-dimethylphenyl isothiocyanate may have potential applications in the development of new drugs or pharmaceuticals due to its unique chemical properties.
Check Digit Verification of cas no
The CAS Registry Mumber 32265-82-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,2,2,6 and 5 respectively; the second part has 2 digits, 8 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 32265-82:
(7*3)+(6*2)+(5*2)+(4*6)+(3*5)+(2*8)+(1*2)=100
100 % 10 = 0
So 32265-82-0 is a valid CAS Registry Number.
InChI:InChI=1/C9H8BrNS/c1-6-3-8(10)4-7(2)9(6)11-5-12/h3-4H,1-2H3