3238-55-9 Usage
Description
2-Propionylpyridine, also known as 2-(1-Oxopropyl)pyridine, is an organic compound with the molecular formula C8H9NO. It is a derivative of pyridine, featuring a propionyl group attached to the 2nd carbon position. 2-Propionylpyridine is known for its versatile chemical properties and potential applications in various industries.
Uses
Used in Pharmaceutical Industry:
2-Propionylpyridine is used as a key intermediate in the synthesis of various pharmaceutical compounds. It serves as a building block for the preparation of Oxodiphenyldihydropyrazolecarboxamide derivatives and analogs, which are known for their potential as ACSS2 inhibitors. These inhibitors play a crucial role in the development of treatments for various diseases, including cancer and other ACSS2-related conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 3238-55-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,2,3 and 8 respectively; the second part has 2 digits, 5 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 3238-55:
(6*3)+(5*2)+(4*3)+(3*8)+(2*5)+(1*5)=79
79 % 10 = 9
So 3238-55-9 is a valid CAS Registry Number.
InChI:InChI=1/C8H9NO/c1-2-8(10)7-5-3-4-6-9-7/h3-6H,2H2,1H3
3238-55-9Relevant articles and documents
1-(2-Pyridyl)-2-propen-1-ol: a multipurpose reagent in organic synthesis
Giomi, Donatella,Piacenti, Michela,Alfini, Renzo,Brandi, Alberto
experimental part, p. 7048 - 7055 (2009/12/06)
A peculiar thermal behaviour of hydroxyallylpyridyl derivatives, likely associated to the weak acidity of the 'picoline-type' hydrogen atom and responsible for the formation of allyl inversion products, has been reported. The 'mobility' of the same hydrog