32648-01-4 Usage
Description
DIBUTYRIN, also known as dibutyryl glycerol, is a diester derived from the condensation of the secondary hydroxy group and one of the primary hydroxy groups of glycerol with butyric acid. It is a small molecule with potential applications in various industries due to its unique chemical properties.
Uses
Used in Pharmaceutical Industry:
DIBUTYRIN is used as a prodrug for enhancing the bioavailability of certain drugs, particularly those with poor water solubility. Its esterification with butyric acid increases the lipophilicity, allowing for better absorption and distribution in the body.
Used in Cosmetic Industry:
In the cosmetic industry, DIBUTYRIN is used as an emollient and skin conditioning agent. Its ability to form esters with hydroxy groups in glycerol contributes to its moisturizing and skin softening properties, making it a valuable ingredient in various cosmetic products.
Used in Food Industry:
DIBUTYRIN can be used as a flavoring agent in the food industry. The esterification with butyric acid provides a unique taste and aroma, which can be utilized to enhance the flavor of certain food products.
Used in Chemical Research:
In the field of chemical research, DIBUTYRIN serves as a model compound for studying the properties and reactions of esters. Its synthesis and characterization can provide insights into the behavior of similar molecules and contribute to the development of new chemical processes and applications.
Check Digit Verification of cas no
The CAS Registry Mumber 32648-01-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,2,6,4 and 8 respectively; the second part has 2 digits, 0 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 32648-01:
(7*3)+(6*2)+(5*6)+(4*4)+(3*8)+(2*0)+(1*1)=104
104 % 10 = 4
So 32648-01-4 is a valid CAS Registry Number.
InChI:InChI=1/C11H20O5/c1-3-5-10(13)15-7-9(12)8-16-11(14)6-4-2/h9,12H,3-8H2,1-2H3
