32683-07-1 Usage
Description
2-([Imino(Phenyl)Methyl]Amino)Acetic Acid is an organic compound characterized by the presence of an imino group attached to a phenyl ring, which is connected to a methylene group and an amino group. This molecule is further linked to an acetic acid group, giving it unique chemical properties and reactivity. It is known for its ability to form imidoesters, which are significant in various chemical reactions and applications.
Uses
Used in Chemical Synthesis:
2-([Imino(Phenyl)Methyl]Amino)Acetic Acid is used as a reagent for preparing imidoesters through chemical reactions. The formation of imidoesters is crucial in various synthetic processes, particularly in the creation of complex organic molecules and pharmaceutical compounds.
Used in Protein Modification:
In the field of biochemistry, 2-([Imino(Phenyl)Methyl]Amino)Acetic Acid is utilized for the modification of proteins. The reaction of imidoesters with proteins allows for the alteration of protein properties, which can be essential for research and development in areas such as drug design, protein engineering, and understanding protein functions.
Used in Pharmaceutical Industry:
2-([Imino(Phenyl)Methyl]Amino)Acetic Acid is used as an intermediate in the synthesis of pharmaceutical compounds. Its unique structure and reactivity make it a valuable component in the development of new drugs, potentially leading to the creation of innovative treatments and therapies.
Used in Research and Development:
In academic and industrial research settings, 2-([Imino(Phenyl)Methyl]Amino)Acetic Acid is employed as a key component in the exploration of new chemical reactions and mechanisms. Its involvement in the formation of imidoesters can provide insights into the behavior of various organic compounds and contribute to the advancement of chemical knowledge.
Overall, 2-([Imino(Phenyl)Methyl]Amino)Acetic Acid is a versatile compound with applications spanning across chemical synthesis, protein modification, pharmaceutical development, and research. Its unique structure and reactivity make it an essential tool in the hands of chemists and researchers working to innovate and discover new applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 32683-07-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,2,6,8 and 3 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 32683-07:
(7*3)+(6*2)+(5*6)+(4*8)+(3*3)+(2*0)+(1*7)=111
111 % 10 = 1
So 32683-07-1 is a valid CAS Registry Number.
InChI:InChI=1/C9H10N2O2/c10-9(11-6-8(12)13)7-4-2-1-3-5-7/h1-5H,6H2,(H2,10,11)(H,12,13)
32683-07-1Relevant articles and documents
Process for the production of 2-substituted 5-chloroimidazole-4-carbaldehydes
-
, (2008/06/13)
A process for the preparation of 2-substituted 5-chloroimidazole-4-carbaldehydes of the general formula: STR1 in which glycine is reacted with an imido ester of the general formula: STR2 and the resultant intermediate is converted into the product by a Vilsmeier reagent. The 2-substituted 5-chloroimidazole-4-carbaldehydes are valuable intermediates for the preparation of pharmaceuticals or herbicidally active compounds.
