329249-53-8 Usage
General Description
2-Amino-5-[[4-[2-(methyl-2-pyridinylamino)ethoxy]phenyl]methyl]-4(5H)-thiazolone is a chemical compound with the molecular formula C19H21N5OS. It is a thiazole derivative and its structure contains an amino group, a pyridine ring, and a thiazolone ring. 2-Amino-5-[[4-[2-(methyl-2-pyridinylamino)ethoxy]phenyl]methyl]-4(5H)-thiazolone is most commonly used in scientific research and drug development. Its properties and potential applications are still being explored, but it has shown promising results as an antiviral, anti-inflammatory, and antimicrobial agent. Its unique structure suggests that it may have potential use in pharmaceuticals and as an ingredient in various medical and cosmetic products.
Check Digit Verification of cas no
The CAS Registry Mumber 329249-53-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,2,9,2,4 and 9 respectively; the second part has 2 digits, 5 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 329249-53:
(8*3)+(7*2)+(6*9)+(5*2)+(4*4)+(3*9)+(2*5)+(1*3)=158
158 % 10 = 8
So 329249-53-8 is a valid CAS Registry Number.
InChI:InChI=1/C18H20N4O2S/c1-22(16-4-2-3-9-20-16)10-11-24-14-7-5-13(6-8-14)12-15-17(23)21-18(19)25-15/h2-9,15H,10-12H2,1H3,(H2,19,21,23)