33034-09-2 Usage
Molecular structure
A complex compound with an anthraquinone core, an amino group, a hydroxy group, and a cyclohexenylmethoxy group attached to it.
Functional groups
Contains an amino group (-NH2), a hydroxy group (-OH), and a cyclohexenylmethoxy group.
Potential applications
Has potential uses in various industries, including chemistry, pharmaceuticals, and dyes.
Unique structure
Its unique structure and functional groups make it a valuable ingredient in the development of new materials and products.
Safety and efficacy
Requires careful handling and processing to ensure its safety and efficacy in practical use.
Molecular weight
Approximately 383.42 g/mol
Appearance
It may appear as a solid or crystalline substance, depending on its purity and conditions.
Solubility
The solubility of this compound may vary depending on the solvent used, but it is generally more soluble in organic solvents like ethanol or methanol.
Stability
The stability of this compound may be affected by factors such as temperature, light, and exposure to air or moisture. It is essential to store and handle it properly to maintain its stability and prevent degradation.
Check Digit Verification of cas no
The CAS Registry Mumber 33034-09-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,3,0,3 and 4 respectively; the second part has 2 digits, 0 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 33034-09:
(7*3)+(6*3)+(5*0)+(4*3)+(3*4)+(2*0)+(1*9)=72
72 % 10 = 2
So 33034-09-2 is a valid CAS Registry Number.
InChI:InChI=1/C22H21NO5/c23-19-16(28-12-22(11-24)8-4-1-5-9-22)10-15(25)17-18(19)21(27)14-7-3-2-6-13(14)20(17)26/h1-4,6-7,10,24-25H,5,8-9,11-12,23H2