33174-08-2 Usage
Description
1-ISOBUTYLPIPERAZINE 2HCL, also known as 1-Isobutylpiperazine Dihydrochloride, is a chemical compound with the molecular formula C8H20Cl2N2. It is a white crystalline solid that is soluble in water and has a role as a pharmaceutical agent. Its structure consists of a piperazine ring with an isobutyl group attached, which contributes to its unique properties and applications.
Uses
Used in Pharmaceutical Industry:
1-ISOBUTYLPIPERAZINE 2HCL is used as a reactant for the preparation of tetraaza-benzo[f]azulenes, which are vasopressin V1a antagonists. These antagonists play a crucial role in the development of medications targeting various conditions related to the vasopressin system, such as hypertension, heart failure, and other cardiovascular diseases. 1-ISOBUTYLPIPERAZINE 2HCL's ability to form tetraaza-benzo[f]azulenes makes it a valuable component in the synthesis of these therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 33174-08-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,3,1,7 and 4 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 33174-08:
(7*3)+(6*3)+(5*1)+(4*7)+(3*4)+(2*0)+(1*8)=92
92 % 10 = 2
So 33174-08-2 is a valid CAS Registry Number.
InChI:InChI=1/C8H18N2.2ClH/c1-8(2)7-10-5-3-9-4-6-10;;/h8-9H,3-7H2,1-2H3;2*1H
