3326-63-4 Usage
Description
H-TRP-BETANA, also known as N-(2-naphthyl)-L-tryptophan amide, is an L-tryptophan derivative obtained by formal condensation of the carboxy group of L-tryptophan with the amino group of 2-naphthylamine. It is a white powder with unique chemical properties that make it suitable for various applications.
Uses
Used in Pharmaceutical Industry:
H-TRP-BETANA is used as a pharmaceutical compound for its potential therapeutic applications. Its unique structure allows it to interact with specific biological targets, making it a promising candidate for the development of new drugs.
Used in Research and Development:
In the field of research and development, H-TRP-BETANA serves as a valuable tool for studying the interactions between biological molecules and understanding the underlying mechanisms of various diseases. Its use in this context can lead to the discovery of novel therapeutic strategies and the development of more effective treatments.
Used in Chemical Synthesis:
H-TRP-BETANA can be utilized as a key intermediate in the synthesis of other complex organic compounds, particularly those with potential applications in the pharmaceutical, agrochemical, and materials science industries. Its unique structure and reactivity make it a versatile building block for the creation of new molecules with diverse properties and functions.
Used in Analytical Chemistry:
As a chemical standard or reference material, H-TRP-BETANA can be employed in analytical chemistry for the calibration of instruments, validation of analytical methods, and quality control of chemical products. Its well-defined structure and purity make it an ideal candidate for these applications, ensuring accurate and reliable results in various analytical techniques.
Check Digit Verification of cas no
The CAS Registry Mumber 3326-63-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,3,2 and 6 respectively; the second part has 2 digits, 6 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 3326-63:
(6*3)+(5*3)+(4*2)+(3*6)+(2*6)+(1*3)=74
74 % 10 = 4
So 3326-63-4 is a valid CAS Registry Number.
InChI:InChI=1/C21H19N3O/c22-19(12-16-13-23-20-8-4-3-7-18(16)20)21(25)24-17-10-9-14-5-1-2-6-15(14)11-17/h1-11,13,19,23H,12,22H2,(H,24,25)/t19-/m0/s1