33401-01-3 Usage
Description
Benzyl 2-Acetamido-2-deoxy-3,4-di-O-acetyl-a-D-glucopyranoside is a white solid that serves as a crucial intermediate in the synthesis of various carbohydrates and oligosaccharides. Its unique chemical structure allows for the creation of a wide range of complex carbohydrate molecules, making it an essential compound in the field of organic chemistry and biochemistry.
Uses
Used in Pharmaceutical Industry:
Benzyl 2-Acetamido-2-deoxy-3,4-di-O-acetyl-a-D-glucopyranoside is used as a synthetic intermediate for the preparation of pharmaceutical compounds. Its ability to form complex carbohydrate structures makes it a valuable component in the development of drugs targeting specific biological receptors.
Used in Research and Development:
In the field of research and development, Benzyl 2-Acetamido-2-deoxy-3,4-di-O-acetyl-a-D-glucopyranoside is used as a key building block for the synthesis of novel carbohydrate-based molecules. This allows scientists to explore new avenues in drug discovery and the development of advanced materials with potential applications in various industries.
Used in Food Industry:
Benzyl 2-Acetamido-2-deoxy-3,4-di-O-acetyl-a-D-glucopyranoside is also utilized in the food industry as a component in the synthesis of various additives and flavor enhancers. Its role in creating complex carbohydrate structures enables the development of innovative products with improved taste and texture.
Used in Cosmetics Industry:
In the cosmetics industry, Benzyl 2-Acetamido-2-deoxy-3,4-di-O-acetyl-a-D-glucopyranoside is employed as a component in the formulation of skincare and beauty products. Its ability to form complex carbohydrate structures contributes to the development of advanced formulations with enhanced efficacy and improved skin compatibility.
Overall, Benzyl 2-Acetamido-2-deoxy-3,4-di-O-acetyl-a-D-glucopyranoside is a versatile compound with a wide range of applications across various industries, including pharmaceuticals, research and development, food, and cosmetics. Its unique chemical properties and ability to form complex carbohydrate structures make it an invaluable asset in the development of innovative products and solutions.
Check Digit Verification of cas no
The CAS Registry Mumber 33401-01-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,3,4,0 and 1 respectively; the second part has 2 digits, 0 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 33401-01:
(7*3)+(6*3)+(5*4)+(4*0)+(3*1)+(2*0)+(1*1)=63
63 % 10 = 3
So 33401-01-3 is a valid CAS Registry Number.
InChI:InChI=1/C19H25NO8/c1-11(22)20-16-18(27-13(3)24)17(26-12(2)23)15(9-21)28-19(16)25-10-14-7-5-4-6-8-14/h4-8,15-19,21H,9-10H2,1-3H3,(H,20,22)/t15?,16-,17+,18+,19-/m0/s1
33401-01-3Relevant articles and documents
SYNTHESIS OF URONOYLDIPEPTIDE DERIVATIVES OF N-ACETYLGLUCOSAMINE AND OF N-ACETYLMURAMOYLDIPEPTIDE
Kur'yanov, V. O.,Chirva, V. Ya.,Zemlyakov, A. E.
, p. 725 - 728 (2007/10/02)
Starting from benzyl 3,4-di-O-acetyl-6-O-trityl-N-acetyl-β-glucosamine and benzyl α-benzyl-4-O-acetyl-N-acetylmuramate, 2-acetamido-2-deoxy-D-glucopyranuronyl-L-alanyl-D-isoglutamine and O-(2-acetamido-2-deoxy-D-glucopyranuronyl-L-alanyl-D-isoglutamin-3-y