335153-21-4 Usage
Description
2-(2-forMyl-4-nitrophenoxy)hexanoic acid, also known as 2-(2'-Formyl-4'-nitrophenoxy)caproic acid, is an organic compound with the molecular formula C13H17NO5. It is characterized by its nitrophenoxy group and formyl functionality, which contribute to its reactivity and potential applications in chemical synthesis.
Uses
Used in Pharmaceutical Synthesis:
2-(2-forMyl-4-nitrophenoxy)hexanoic acid is used as an intermediate in the synthetic preparation of 7-Amino-4,5-dihydrobenzo[f][1,4]oxazepin-3-ones. These compounds are of interest in the pharmaceutical industry due to their potential therapeutic properties, including possible applications in the treatment of various medical conditions.
In the context of synthetic chemistry, 2-(2-forMyl-4-nitrophenoxy)hexanoic acid serves as a key building block for the creation of more complex molecular structures with potential pharmaceutical relevance. Its unique functional groups allow for further chemical modifications and the development of novel drug candidates.
Check Digit Verification of cas no
The CAS Registry Mumber 335153-21-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,3,5,1,5 and 3 respectively; the second part has 2 digits, 2 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 335153-21:
(8*3)+(7*3)+(6*5)+(5*1)+(4*5)+(3*3)+(2*2)+(1*1)=114
114 % 10 = 4
So 335153-21-4 is a valid CAS Registry Number.
InChI:InChI=1/C13H15NO6/c1-2-3-4-12(13(16)17)20-11-6-5-10(14(18)19)7-9(11)8-15/h5-8,12H,2-4H2,1H3,(H,16,17)
335153-21-4Relevant articles and documents
Intermediates for making a bezofuran or benzothiophene derivative nitrated in position 5 and uses thereof
-
Page/Page column 16-17, (2008/06/13)
The invention concerns novel nitroaromatic compounds of general formula (I′) wherein: R, R′1, R2, Z and n are as defined in claim 1. The invention also concerns a method for preparing nitroaromatic compounds nitrated in position 4. The invention further c
