343926-69-2 Usage
Description
2-Pyrimidinamine, 4-bromo(9CI) is an organic compound with the molecular formula C4H4BrN3. It is a heterocyclic compound featuring a pyrimidine ring with an amine group at the 2nd position and a bromine atom at the 4th position. 2-Pyrimidinamine, 4-bromo(9CI) is known for its potential applications in various industries due to its unique chemical structure and properties.
Uses
Used in Pharmaceutical Industry:
2-Pyrimidinamine, 4-bromo(9CI) is used as a pharmaceutical intermediate for the synthesis of various drugs. Its unique chemical structure allows it to serve as a building block for the development of new medications, particularly those targeting specific biological pathways or receptors.
Used in Agrochemical Industry:
In the agrochemical industry, 2-Pyrimidinamine, 4-bromo(9CI) is utilized as an important organic intermediate. It plays a crucial role in the development of new agrochemical products, such as pesticides and herbicides, that can help improve crop protection and yield.
Used in Dyestuff Industry:
2-Pyrimidinamine, 4-bromo(9CI) is also employed in the dyestuff industry as an essential organic intermediate. Its unique chemical properties make it suitable for the synthesis of various dyes and pigments used in different applications, including textiles, plastics, and printing inks.
Check Digit Verification of cas no
The CAS Registry Mumber 343926-69-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,4,3,9,2 and 6 respectively; the second part has 2 digits, 6 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 343926-69:
(8*3)+(7*4)+(6*3)+(5*9)+(4*2)+(3*6)+(2*6)+(1*9)=162
162 % 10 = 2
So 343926-69-2 is a valid CAS Registry Number.
InChI:InChI=1/C4H4BrN3/c5-3-1-2-7-4(6)8-3/h1-2H,(H2,6,7,8)
