344562-80-7 Usage
Description
(4-Methylphenyl) [4-(2-methylpropyl)phenyl] iodonium hexafluorophosphate is an organic phosphorus compound characterized by its unique molecular structure, which features a phenyl group with a methyl substitution at the para position and another phenyl group with a 2-methylpropyl substitution at the para position. The iodonium cation is connected to the phenyl groups, and the hexafluorophosphate anion completes the ionic compound. (4-Methylphenyl) [4-(2-methylpropyl)phenyl] iodonium hexafluorophosphate is known for its potential applications in various industries due to its chemical properties.
Uses
(4-Methylphenyl) [4-(2-methylpropyl)phenyl] iodonium hexafluorophosphate is used as an intermediate for synthetic materials due to its organic phosphorus nature, which allows for further chemical reactions and the creation of a wide range of products.
Used in Chemical Synthesis Industry:
(4-Methylphenyl) [4-(2-methylpropyl)phenyl] iodonium hexafluorophosphate is used as a synthetic intermediate for the production of various organic compounds. Its unique structure and reactivity make it a valuable building block in the synthesis of pharmaceuticals, agrochemicals, and other specialty chemicals.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, (4-Methylphenyl) [4-(2-methylpropyl)phenyl] iodonium hexafluorophosphate is used as a key intermediate in the synthesis of certain drugs. Its specific structural features can be exploited to design and develop novel therapeutic agents with improved efficacy and selectivity.
Used in Material Science:
(4-Methylphenyl) [4-(2-methylpropyl)phenyl] iodonium hexafluorophosphate is also used in the field of material science for the development of new materials with specific properties. Its incorporation into polymers or other materials can lead to enhanced performance characteristics, such as improved thermal stability, flame retardancy, or electrical conductivity.
Check Digit Verification of cas no
The CAS Registry Mumber 344562-80-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,4,4,5,6 and 2 respectively; the second part has 2 digits, 8 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 344562-80:
(8*3)+(7*4)+(6*4)+(5*5)+(4*6)+(3*2)+(2*8)+(1*0)=147
147 % 10 = 7
So 344562-80-7 is a valid CAS Registry Number.
InChI:InChI=1/C17H20I.F6P/c1-13(2)12-15-6-10-17(11-7-15)18-16-8-4-14(3)5-9-16;1-7(2,3,4,5)6/h4-11,13H,12H2,1-3H3;/q+1;-1
