34461-49-9 Usage
Molecular Structure
A complex structure consisting of a β-D-glucopyranuronic acid backbone with a fluorenylmethyloxycarbonyl (FMOC) group attached to the amino group.
Role as a Synthetic Intermediate
Frequently used in organic chemistry and biochemistry research to synthesize other compounds.
Carbohydrate Chemistry
The compound's unique structure and properties make it useful for studying carbohydrate chemistry.
Pharmaceutical Development
Utilized in the development of new pharmaceuticals due to its complex molecular structure and potential applications.
Material Science
Possesses potential for use in creating new materials for various applications.
Potential Applications
The compound has applications in drug delivery systems, tissue engineering, and diagnostics.
Research Potential
Further research on 1-Deoxy-1-[(9H-fluoren-2-ylamino)oxy]-β-D-glucopyranuronic acid could lead to new and innovative technologies and products.
Check Digit Verification of cas no
The CAS Registry Mumber 34461-49-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,4,4,6 and 1 respectively; the second part has 2 digits, 4 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 34461-49:
(7*3)+(6*4)+(5*4)+(4*6)+(3*1)+(2*4)+(1*9)=109
109 % 10 = 9
So 34461-49-9 is a valid CAS Registry Number.
InChI:InChI=1/C19H19NO7/c21-14-15(22)17(18(24)25)26-19(16(14)23)27-20-11-5-6-13-10(8-11)7-9-3-1-2-4-12(9)13/h1-6,8,14-17,19-23H,7H2,(H,24,25)/t14-,15-,16+,17-,19-/m0/s1