3447-53-8 Usage
Description
4-(Difluoromethoxy)benzyl bromide is an organic compound that serves as a crucial intermediate in the synthesis of various chemical products. It is characterized by its unique chemical structure, which features a difluoromethoxy group and a benzyl bromide group, making it a versatile building block in the development of new molecules for different applications.
Uses
Used in Organic Synthesis:
4-(Difluoromethoxy)benzyl bromide is used as a key intermediate for the synthesis of complex organic molecules. Its unique structure allows for further functionalization and modification, making it a valuable component in the creation of novel compounds with specific properties and applications.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 4-(Difluoromethoxy)benzyl bromide is used as a building block for the development of new drugs. Its incorporation into drug candidates can potentially enhance their pharmacological properties, such as bioavailability, potency, and selectivity, leading to more effective treatments for various diseases.
Used in Agrochemicals:
4-(Difluoromethoxy)benzyl bromide is also utilized in the agrochemical industry as a starting material for the synthesis of new pesticides and other agricultural chemicals. Its unique structure can contribute to the development of more effective and environmentally friendly products that can help improve crop protection and yield.
Used in Dye Industry:
In the dye industry, 4-(Difluoromethoxy)benzyl bromide is used as a raw material for the production of various dyes and pigments. Its chemical properties can be exploited to create dyes with improved colorfastness, brightness, and stability, which are essential for various applications, such as textiles, plastics, and printing inks.
Check Digit Verification of cas no
The CAS Registry Mumber 3447-53-8 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,4,4 and 7 respectively; the second part has 2 digits, 5 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 3447-53:
(6*3)+(5*4)+(4*4)+(3*7)+(2*5)+(1*3)=88
88 % 10 = 8
So 3447-53-8 is a valid CAS Registry Number.
InChI:InChI=1/C8H7BrF2O/c9-5-6-1-3-7(4-2-6)12-8(10)11/h1-4,8H,5H2
3447-53-8Relevant articles and documents
FLUORINE-CONTAINING AMINO ACIDS. VII. POLYFLUOROALKOXY AND POLYFLUOROMETHYLTHIO DERIVATIVES OF PHENYLALANINE
Kolycheva, M. T.,Yagupol'skii, Yu. L.,Gerus, I. I.,Godunova, L. F.,Kukhar, V. P.
, p. 1174 - 1179 (2007/10/02)
The reaction of polyfluoroalkoxy- and polyfluoromethylthio-substituted benzyl bromides with N-formylaminomalonic ester, followed by decarboxylation and alkaline hydrolysis, gave the corresponding derivatives of phenylalanine with fluorine-containing subst