34493-87-3 Usage
General Description
8-quinolyl acrylate is a chemical compound that belongs to the class of acrylates, which are esters of acrylic acid. It is characterized by the presence of a quinolyl group, which is a heterocyclic aromatic ring structure containing a nitrogen atom. 8-quinolyl acrylate is commonly used in organic synthesis and as a building block for the production of various pharmaceuticals, agrochemicals, and functional materials. Its unique structure and reactivity make it a valuable intermediate in the development of new chemical entities for various applications. Additionally, 8-quinolyl acrylate has been studied for its potential biological activities and has been shown to exhibit antimicrobial and anti-inflammatory properties, making it an interesting molecule for further research and development.
Check Digit Verification of cas no
The CAS Registry Mumber 34493-87-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,4,4,9 and 3 respectively; the second part has 2 digits, 8 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 34493-87:
(7*3)+(6*4)+(5*4)+(4*9)+(3*3)+(2*8)+(1*7)=133
133 % 10 = 3
So 34493-87-3 is a valid CAS Registry Number.
InChI:InChI=1/C12H9NO2/c1-2-11(14)15-10-7-3-5-9-6-4-8-13-12(9)10/h2-8H,1H2
34493-87-3Relevant articles and documents
Preparation process of low-cost and environment-friendly bisphenol S
-
Paragraph 0019; 0034; 0043; 0046; 0055; 0058; 0067, (2021/11/26)
The invention discloses a preparation process of bisphenol S with low cost and environmental protection. When the corrosion-resistant paint is sprayed into the interior of the reaction kettle, N atoms and O atoms of the reinforcing filler can interact with the metal ions to form a chelate. The acid resistance of the reaction kettle is higher, and the preparation cost is further reduced.
