348-65-2 Usage
Description
5-Chloro-2,4-difluoroaniline is an organic compound that belongs to the class of aniline derivatives. It is characterized by the presence of a chlorine atom at the 5th position and two fluorine atoms at the 2nd and 4th positions on the benzene ring, with an amino group attached to the nitrogen atom. 5-Chloro-2,4-difluoroaniline is known for its potential applications in various industries due to its unique chemical properties.
Uses
Used in Pharmaceutical Industry:
5-Chloro-2,4-difluoroaniline is used as a reactant or reagent in the preparation of aminoisoxazoline compounds. These compounds serve as agonists of α7-nicotinic acetylcholine receptors, which play a crucial role in various physiological processes and have potential therapeutic applications in the treatment of cognitive disorders, neurodegenerative diseases, and other conditions related to the central nervous system.
Check Digit Verification of cas no
The CAS Registry Mumber 348-65-2 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 3,4 and 8 respectively; the second part has 2 digits, 6 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 348-65:
(5*3)+(4*4)+(3*8)+(2*6)+(1*5)=72
72 % 10 = 2
So 348-65-2 is a valid CAS Registry Number.
InChI:InChI=1/C6H4ClF2N/c7-3-1-6(10)5(9)2-4(3)8/h1-2H,10H2