3482-86-8 Usage
Description
N-ETHYLGUANIDINIUM SULFATE, also known as 1-Ethylguanidine sulfate, is a chemical compound that exists in the form of white crystals. It is commonly utilized in various chemical synthesis studies due to its unique properties and reactivity.
Uses
Used in Chemical Synthesis Studies:
N-ETHYLGUANIDINIUM SULFATE is used as a reagent for chemical synthesis processes. Its application is primarily due to its unique chemical properties, which allow it to participate in various reactions and contribute to the formation of different compounds.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, N-ETHYLGUANIDINIUM SULFATE is used as an intermediate in the synthesis of various drugs. Its role is crucial in the development of new medications, as it can be manipulated to create a wide range of pharmaceutical compounds with specific therapeutic properties.
Used in Research and Development:
N-ETHYLGUANIDINIUM SULFATE is also employed in research and development settings, where it is used to study the properties and behavior of different chemical compounds. Its use in this context helps scientists gain a deeper understanding of chemical reactions and the potential applications of the synthesized products.
Check Digit Verification of cas no
The CAS Registry Mumber 3482-86-8 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,4,8 and 2 respectively; the second part has 2 digits, 8 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 3482-86:
(6*3)+(5*4)+(4*8)+(3*2)+(2*8)+(1*6)=98
98 % 10 = 8
So 3482-86-8 is a valid CAS Registry Number.
InChI:InChI=1/C3H9N3/c1-2-6-3(4)5/h2H2,1H3,(H4,4,5,6)/p+1
3482-86-8Relevant articles and documents
In Vitro and in Vivo Inhibition of the Mycobacterium tuberculosis Phosphopantetheinyl Transferase PptT by Amidinoureas
Ottavi, Samantha,Scarry, Sarah M.,Mosior, John,Ling, Yan,Roberts, Julia,Singh, Amrita,Zhang, David,Goullieux, Laurent,Roubert, Christine,Bacqué, Eric,Lagiakos, H. Rachel,Vendome, Jeremie,Moraca, Francesca,Li, Kelin,Perkowski, Andrew J.,Ramesh, Remya,Bowler, Matthew M.,Tracy, William,Feher, Victoria A.,Sacchettini, James C.,Gold, Ben S.,Nathan, Carl F.,Aubé, Jeffrey
, p. 1996 - 2022 (2022/01/31)
A newly validated target for tuberculosis treatment is phosphopantetheinyl transferase, an essential enzyme that plays a critical role in the biosynthesis of cellular lipids and virulence factors in Mycobacterium tuberculosis. The structure-activity relat
Some 2-substitution derivatives of 5-(4-oxo-6-hydroxy-3,4-dihydro-5-pyrimidinyl)pentanoic acid
Krepelka,Benes,Pouzar,et al.
, p. 304 - 311 (2007/10/02)
-
