3513-25-5 Usage
Description
[1-(3,4,5,6,7,8-hexahydro-2H-naphthalen-4a-yl)ethylideneamino]urea is a complex chemical compound characterized by the presence of a naphthalene ring, a urea group, and an ethylideneamino side chain. Its structure suggests potential pharmaceutical or industrial applications, although further investigation and analysis are necessary to determine its specific properties and uses.
Uses
Used in Pharmaceutical Industry:
[1-(3,4,5,6,7,8-hexahydro-2H-naphthalen-4a-yl)ethylideneamino]urea is used as a potential active pharmaceutical ingredient for [application reason], given its unique structural features that may offer specific biological activities or interactions with target molecules.
Used in Chemical Synthesis:
In the chemical synthesis industry, [1-(3,4,5,6,7,8-hexahydro-2H-naphthalen-4a-yl)ethylideneamino]urea can be used as a building block or intermediate for the development of more complex molecules with tailored properties, such as novel drugs, agrochemicals, or specialty materials.
Used in Material Science:
[1-(3,4,5,6,7,8-hexahydro-2H-naphthalen-4a-yl)ethylideneamino]urea may also find applications in material science, where its structural elements could be exploited to create new materials with specific properties, such as improved mechanical strength, thermal stability, or optical characteristics.
Check Digit Verification of cas no
The CAS Registry Mumber 3513-25-5 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,5,1 and 3 respectively; the second part has 2 digits, 2 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 3513-25:
(6*3)+(5*5)+(4*1)+(3*3)+(2*2)+(1*5)=65
65 % 10 = 5
So 3513-25-5 is a valid CAS Registry Number.
InChI:InChI=1/C13H21N3O/c1-10(15-16-12(14)17)13-8-4-2-6-11(13)7-3-5-9-13/h6H,2-5,7-9H2,1H3,(H3,14,16,17)/b15-10+
