352018-88-3 Usage
General Description
5-Phenyl-1,3-oxazole-4-methanol is a chemical compound with the molecular formula C10H9NO2. It is a derivative of oxazole, which is a five-membered heterocyclic compound containing one oxygen and one nitrogen atom in the ring. 5-Phenyl-1,3-oxazole-4-methanol has a phenyl group attached to the third carbon atom of the oxazole ring and a hydroxyl group attached to the fourth carbon atom. It is used in organic synthesis and medicinal chemistry as a building block for the construction of various pharmaceutical compounds and biologically active substances. The presence of both the phenyl and hydroxyl functional groups in the molecule gives it potential for a wide range of chemical and biological applications.
Check Digit Verification of cas no
The CAS Registry Mumber 352018-88-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,5,2,0,1 and 8 respectively; the second part has 2 digits, 8 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 352018-88:
(8*3)+(7*5)+(6*2)+(5*0)+(4*1)+(3*8)+(2*8)+(1*8)=123
123 % 10 = 3
So 352018-88-3 is a valid CAS Registry Number.
InChI:InChI=1/C10H9NO2/c12-6-9-10(13-7-11-9)8-4-2-1-3-5-8/h1-5,7,12H,6H2