35242-17-2 Usage
Description
3-Chloro bicyclo[3.2.1]oct-2-ene is a chemical compound that belongs to the class of bicyclic compounds. It is characterized by the presence of a chlorine atom attached to the third carbon atom in the bicyclic structure. 3-CHLOROBICYCLO[3.2.1]OCT-2-ENE is known for its unique chemical properties and potential applications in various industries.
Uses
Used in Chemical Synthesis:
3-Chloro bicyclo[3.2.1]oct-2-ene is used as an intermediate in the synthesis of various organic compounds. Its unique structure and reactivity make it a valuable building block for the development of new molecules with diverse applications.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 3-chloro bicyclo[3.2.1]oct-2-ene is used as a key component in the synthesis of certain drugs. Its specific functional groups and structural features allow for the creation of novel drug candidates with potential therapeutic benefits.
Used in Material Science:
3-Chloro bicyclo[3.2.1]oct-2-ene is also utilized in the field of material science for the development of new polymers and materials with specific properties. Its incorporation into polymer structures can lead to enhanced mechanical, thermal, or chemical characteristics, depending on the desired application.
Used in Birch Reduction:
3-Chloro bicyclo[3.2.1]oct-2-ene has been specifically used in the preparation of bicyclo[3.2.1]oct-2-ene through a process called Birch reduction. This reduction technique involves the use of alkali metals, such as lithium or sodium, in an aprotic solvent to convert aromatic compounds to their corresponding cyclohexadiene derivatives. The resulting bicyclo[3.2.1]oct-2-ene can be further utilized in various chemical reactions and applications.
Check Digit Verification of cas no
The CAS Registry Mumber 35242-17-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,5,2,4 and 2 respectively; the second part has 2 digits, 1 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 35242-17:
(7*3)+(6*5)+(5*2)+(4*4)+(3*2)+(2*1)+(1*7)=92
92 % 10 = 2
So 35242-17-2 is a valid CAS Registry Number.
InChI:InChI=1/C8H11Cl/c9-8-4-6-1-2-7(3-6)5-8/h4,6-7H,1-3,5H2
35242-17-2Relevant articles and documents
Polycyclo Dyes and Use Thereof
-
, (2013/06/05)
The invention relates to a family of fluorescent compounds that comprise a bridged polycyclo moiety. The compounds can be chemically linked to biomolecules, such as proteins, nucleic acids, and therapeutic small molecules. The compounds can be used for imaging in a variety of medical, biological and diagnostic applications, and are particularly useful for the in vivo imaging of regions of interest within a mammal.
3-Trimethylsilylbicyclo[3.2.1]oct-2-ene in the synthesis of functionalized bicyclo[3.2.1]octane systems
Patil, Govindagouda S.,Nagendrappa, Gopalpur
, p. 1019 - 1024 (2007/10/03)
3-Trimethylsilylbicyclo[3.2.1]oct-2-ene 5 is shown to be useful in the synthesis of functionalized bicyclo[3.2.1]octanes. It undergoes acylation to give 3-bicyclo[3.2.1]oct-2-enyl ketones 6-10 without undergoing skeletal rearrangement, in contrast to the acylation of 2-trimethylsilylbicyclo[2.2.1]hept-2-ene 23. It can be epoxidized and the epoxysilane 21 hydrolyzes to the silyldiol 22 in normal way as against the resistance of 2-trimethylsilylbicyclo[2.2.1]hept-2-ene epoxide 24 towards hydrolysis.
