352530-36-0 Usage
General Description
(2-Chloro-5-pyridyl)methylzinc chloride is an organozinc reagent commonly used in organic synthesis. It is a highly reactive and versatile compound that can be used in various chemical reactions, such as cross-coupling reactions and addition reactions. As a nucleophilic organozinc reagent, it can react with a wide range of electrophiles, making it a valuable tool in the construction of complex organic molecules. Its ability to form carbon-carbon bonds and carbon-heteroatom bonds makes it a valuable building block in the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals. Despite its reactivity, (2-chloro-5-pyridyl)methylzinc chloride is typically handled and stored under inert atmosphere due to its sensitivity to moisture and air.
Check Digit Verification of cas no
The CAS Registry Mumber 352530-36-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,5,2,5,3 and 0 respectively; the second part has 2 digits, 3 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 352530-36:
(8*3)+(7*5)+(6*2)+(5*5)+(4*3)+(3*0)+(2*3)+(1*6)=120
120 % 10 = 0
So 352530-36-0 is a valid CAS Registry Number.
InChI:InChI=1/C6H5ClN.ClH.Zn/c1-5-2-3-6(7)8-4-5;;/h2-4H,1H2;1H;/q;;+1/p-1/rC6H5Cl2NZn/c7-6-2-1-5(3-9-6)4-10-8/h1-3H,4H2
