3573-62-4 Usage
General Description
D-Glucose-6-14C is a radiolabeled form of glucose, which is a simple sugar and the primary source of energy for cells. The "6-14C" designation indicates that the radiolabel is located on the sixth carbon atom of the glucose molecule. This radiolabeled form of glucose is commonly used in scientific research, particularly in studies related to glucose metabolism, transport, and utilization within cells and tissues. Its radioactive nature allows for the tracking and measurement of glucose uptake and utilization in biological systems, making it a valuable tool for understanding the role of glucose in various physiological and pathological processes. Additionally, the 14C isotope emits radiation that can be detected and quantified, providing important information about the kinetics and distribution of glucose in living organisms.
Check Digit Verification of cas no
The CAS Registry Mumber 3573-62-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,5,7 and 3 respectively; the second part has 2 digits, 6 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 3573-62:
(6*3)+(5*5)+(4*7)+(3*3)+(2*6)+(1*2)=94
94 % 10 = 4
So 3573-62-4 is a valid CAS Registry Number.
InChI:InChI=1/C6H12O6/c7-1-3(9)5(11)6(12)4(10)2-8/h1,3-6,8-12H,2H2/t3-,4+,5+,6+/m0/s1/i2+2
