35988-96-6 Usage
Description
3-[2-(Dimethylamino)ethyl]-1-methoxy-10H-[1,3]dioxolo[6,7]phenanthro[4,5-bcd]pyran-10-one is a complex organic compound with a unique molecular structure. It is a minor alkaloid that has been identified in the roots of Thalictrum minus and is also a constituent of Thalictrum rugosum Ait. 3-[2-(Dimethylamino)ethyl]-1-methoxy-10H-[1,3]dioxolo[6,7]phenanthro[4,5-bcd]pyran-10-one can be separated from the preceding base by column chromatography on alumina and forms colorless crystals when dissolved in ethanol.
Uses
Used in Pharmaceutical Industry:
3-[2-(Dimethylamino)ethyl]-1-methoxy-10H-[1,3]dioxolo[6,7]phenanthro[4,5-bcd]pyran-10-one is used as a pharmaceutical compound for its potential therapeutic applications. 3-[2-(Dimethylamino)ethyl]-1-methoxy-10H-[1,3]dioxolo[6,7]phenanthro[4,5-bcd]pyran-10-one's unique structure and properties make it a promising candidate for the development of new drugs and therapies.
Used in Chemical Research:
In the field of chemical research, 3-[2-(Dimethylamino)ethyl]-1-methoxy-10H-[1,3]dioxolo[6,7]phenanthro[4,5-bcd]pyran-10-one serves as a valuable subject for studying its chemical properties, reactivity, and potential interactions with other molecules. This research can lead to a better understanding of the compound's behavior and its potential applications in various industries.
Used in Material Science:
The unique molecular structure of 3-[2-(Dimethylamino)ethyl]-1-methoxy-10H-[1,3]dioxolo[6,7]phenanthro[4,5-bcd]pyran-10-one may also have applications in material science. Researchers can explore its potential use in the development of new materials with specific properties, such as improved strength, flexibility, or chemical resistance.
Used in Environmental Applications:
Due to its unique chemical properties, 3-[2-(Dimethylamino)ethyl]-1-methoxy-10H-[1,3]dioxolo[6,7]phenanthro[4,5-bcd]pyran-10-one may also find use in environmental applications. For example, it could be studied for its potential to remove pollutants or contaminants from the environment, or to be used in the development of eco-friendly materials and products.
References
Mollov, Thuan, Panov., Compt. Rend. A cad. Bulg. Sci., 24,1047 (1971)
Check Digit Verification of cas no
The CAS Registry Mumber 35988-96-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,5,9,8 and 8 respectively; the second part has 2 digits, 9 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 35988-96:
(7*3)+(6*5)+(5*9)+(4*8)+(3*8)+(2*9)+(1*6)=176
176 % 10 = 6
So 35988-96-6 is a valid CAS Registry Number.
InChI:InChI=1/C21H19NO5/c1-22(2)7-6-11-8-14(24-3)20-17-13(11)5-4-12-9-15-19(26-10-25-15)18(16(12)17)21(23)27-20/h4-5,8-9H,6-7,10H2,1-3H3