360-52-1 Usage
Description
1,1,3,3-Tetrafluoroacetone is an organic compound with the molecular formula C3H2F4O. It is a colorless liquid that is highly reactive due to the presence of four fluorine atoms. 1,1,3,3-tetrafluoroacetone is known for its unique chemical properties and has found various applications in different industries.
Uses
Used in Pharmaceutical Industry:
1,1,3,3-Tetrafluoroacetone is used as a reagent for the chemoenzymic preparation of hexafluoroleucine and tetrafluoroleucine. These compounds are essential for the incorporation into helical peptides via solid-phase peptide synthesis, which is a crucial technique in the development of new drugs and therapeutic agents.
Used in Chemical Synthesis:
1,1,3,3-Tetrafluoroacetone is also used as an intermediate in the synthesis of various fluorinated compounds. Its high reactivity and unique properties make it a valuable building block for creating new molecules with specific characteristics, which can be applied in various fields, including materials science, agrochemicals, and pharmaceuticals.
Check Digit Verification of cas no
The CAS Registry Mumber 360-52-1 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 3,6 and 0 respectively; the second part has 2 digits, 5 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 360-52:
(5*3)+(4*6)+(3*0)+(2*5)+(1*2)=51
51 % 10 = 1
So 360-52-1 is a valid CAS Registry Number.
InChI:InChI=1/C3H2F4O/c4-2(5)1(8)3(6)7/h2-3H
