363179-66-2 Usage
General Description
3,3-difluoro-Piperidine is a chemical compound with the molecular formula C5H8F2N. It is a derivative of piperidine, which is a cyclic amine. 3,3-difluoro-Piperidine is characterized by the presence of two fluorine atoms attached to the third carbon atom in the piperidine ring. It is used in various chemical reactions and synthesis processes due to its unique properties and structure. 3,3-difluoro-Piperidine may also have potential applications in the pharmaceutical industry, as it could be used as a building block for the synthesis of various drug molecules. Its distinctive chemical structure may contribute to its effectiveness and potential utility in pharmaceutical research and development. However, further research and testing are required to fully understand its potential uses and properties.
Check Digit Verification of cas no
The CAS Registry Mumber 363179-66-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,6,3,1,7 and 9 respectively; the second part has 2 digits, 6 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 363179-66:
(8*3)+(7*6)+(6*3)+(5*1)+(4*7)+(3*9)+(2*6)+(1*6)=162
162 % 10 = 2
So 363179-66-2 is a valid CAS Registry Number.
InChI:InChI=1/C5H9F2N/c6-5(7)2-1-3-8-4-5/h8H,1-4H2
363179-66-2Relevant articles and documents
Precursors for depositing silicon-containing films and methods for making and using same
-
Page/Page column 14, (2012/03/26)
Aminosilane precursors for depositing silicon-containing films, and methods for depositing silicon-containing films from these aminosilane precursors, are described herein. In one embodiment, there is provided an aminosilane precursor for depositing silicon-containing film comprising the following formula (I): [in-line-formulae](R1R2N)nSiR34-n??(I)[/in-line-formulae] wherein substituents R1 and R2 are each independently chosen from an alkyl group comprising from 1 to 20 carbon atoms and an aryl group comprising from 6 to 30 carbon atoms, at least one of substituents R1 and R2 comprises at least one electron withdrawing substituent chosen from F, Cl, Br, I, CN, NO2, PO(OR)2, OR, SO, SO2, SO2R and wherein R in the at least one electron withdrawing substituent is chosen from an alkyl group or an aryl group, R3 is chosen from H, an alkyl group, or an aryl group, and n is a number ranging from 1 to 4.
