3647-19-6 Usage
Description
N-(3-Chlorophenyl)-1-aziridinecarboxamide is a chemical compound with the molecular formula C8H9ClN2O. It is an aziridine derivative, which is a class of organic compounds containing a three-membered ring with one amine group and two carbon atoms. N-(3-Chlorophenyl)-1-aziridinecarboxamide features a chlorophenyl group attached to the aziridine ring, along with a carboxamide functional group. It is utilized in organic synthesis and medicinal chemistry as a building block for the preparation of various pharmaceutical compounds.
Uses
Used in Pharmaceutical Industry:
N-(3-Chlorophenyl)-1-aziridinecarboxamide is used as a building block for the synthesis of pharmaceutical compounds due to its unique structural and biological properties. It serves as a key intermediate in the development of drugs with potential applications in treating various diseases.
Used in Organic Synthesis:
In the field of organic synthesis, N-(3-Chlorophenyl)-1-aziridinecarboxamide is used as a versatile reagent for the preparation of a wide range of organic compounds. Its ability to undergo various chemical transformations makes it a valuable component in the synthesis of complex organic molecules.
Used in Medicinal Chemistry:
N-(3-Chlorophenyl)-1-aziridinecarboxamide is used in medicinal chemistry for the development of antitumor, antiviral, and antimicrobial agents. Its structural features contribute to its potential as an active pharmaceutical ingredient in these therapeutic areas.
Used in Asymmetric Synthesis:
N-(3-Chlorophenyl)-1-aziridinecarboxamide has attracted interest for its potential use as a reagent in asymmetric synthesis, a field of chemistry that focuses on the production of enantiomerically pure compounds. Its unique properties make it a promising candidate for the synthesis of chiral molecules with specific biological activities.
Check Digit Verification of cas no
The CAS Registry Mumber 3647-19-6 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,6,4 and 7 respectively; the second part has 2 digits, 1 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 3647-19:
(6*3)+(5*6)+(4*4)+(3*7)+(2*1)+(1*9)=96
96 % 10 = 6
So 3647-19-6 is a valid CAS Registry Number.
InChI:InChI=1/C9H9ClN2O/c10-7-2-1-3-8(6-7)11-9(13)12-4-5-12/h1-3,6H,4-5H2,(H,11,13)
