36548-87-5 Usage
Description
Thulium (III) nitrate is a chemical compound consisting of thulium, a rare earth element, and nitrate ions. It is typically found in the form of a hydrate, with the most common being the pentahydrate. Thulium (III) nitrate exhibits unique properties due to the presence of thulium, which is characterized by its high magnetic susceptibility and luminescent properties.
Uses
Used in Laboratory Applications:
Thulium (III) nitrate is used as a laboratory reagent for various chemical and physical experiments. Its unique properties make it a valuable compound for research and analysis.
Used in Optical Glass Industry:
Thulium (III) nitrate is used in the production of optical glasses due to its ability to enhance the refractive index and improve the optical properties of the glass.
Used in Structural Ceramics:
In the field of structural ceramics, thulium (III) nitrate is utilized to create advanced ceramic materials with improved mechanical and thermal properties.
Used in Catalysts:
Thulium (III) nitrate serves as a catalyst in various chemical reactions, promoting the desired transformations and increasing the efficiency of the processes.
Used in Electrical Components:
In the electrical components industry, thulium (III) nitrate is employed to develop components with enhanced electrical properties, such as improved conductivity and resistance to corrosion.
Used in Photo-Optical Material:
Thulium (III) nitrate is used in the development of photo-optical materials, taking advantage of its luminescent properties to create materials with unique optical characteristics.
Used in Biosensor Analysis:
Thulium (III) nitrate pentahydrate has been used in the synthesis of thulium oxide (Tm2O3) nanorods for modified electrodes in enzyme-based biosensor analysis, providing a sensitive and selective platform for detecting biological molecules.
Used in Synthesis of Lanthanide-Organic Frameworks:
Thulium (III) nitrate pentahydrate can also be used to synthesize hydrophilic, microporous lanthanide-organic frameworks, which have potential applications in gas storage, separation, and catalysis.
Check Digit Verification of cas no
The CAS Registry Mumber 36548-87-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,6,5,4 and 8 respectively; the second part has 2 digits, 8 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 36548-87:
(7*3)+(6*6)+(5*5)+(4*4)+(3*8)+(2*8)+(1*7)=145
145 % 10 = 5
So 36548-87-5 is a valid CAS Registry Number.
InChI:InChI=1/NO3.5H2O.Tm/c2-1(3)4;;;;;;/h;5*1H2;/q-1;;;;;;+3
