36912-83-1 Usage
Description
1-PHENYL-2-(4-PYRIMIDINYL)-ETHANONE, also known as 1-Phenyl-2-(4-pyrimidinyl)ethanone, is an organic compound with the chemical formula C15H13N. It is characterized by its unique molecular structure, which features a phenyl group attached to an ethanone moiety and a pyrimidinyl group. 1-PHENYL-2-(4-PYRIMIDINYL)-ETHANONE is known for its potential applications in various fields due to its chemical properties.
Uses
1-PHENYL-2-(4-PYRIMIDINYL)-ETHANONE is used as a synthetic intermediate for the development of various chemical compounds. Its unique structure allows it to be a valuable building block in the synthesis of a wide range of organic molecules.
Used in Pharmaceutical Industry:
1-PHENYL-2-(4-PYRIMIDINYL)-ETHANONE is used as a key intermediate in the synthesis of pharmaceutical compounds. Its versatile structure enables the development of new drugs with potential therapeutic applications.
Used in Chemical Research:
1-PHENYL-2-(4-PYRIMIDINYL)-ETHANONE is used as a research compound in the field of organic chemistry. It serves as a model system for studying various chemical reactions and understanding the reactivity of different functional groups.
Used in Material Science:
1-PHENYL-2-(4-PYRIMIDINYL)-ETHANONE can be used as a precursor for the development of novel materials with specific properties. Its unique structure may contribute to the creation of new materials with applications in various industries, such as electronics, coatings, and adhesives.
Check Digit Verification of cas no
The CAS Registry Mumber 36912-83-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,6,9,1 and 2 respectively; the second part has 2 digits, 8 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 36912-83:
(7*3)+(6*6)+(5*9)+(4*1)+(3*2)+(2*8)+(1*3)=131
131 % 10 = 1
So 36912-83-1 is a valid CAS Registry Number.
InChI:InChI=1/C12H10N2O/c15-12(10-4-2-1-3-5-10)8-11-6-7-13-9-14-11/h1-7,9H,8H2
36912-83-1Relevant articles and documents
An efficient and practical method for the synthesis of the 5-acylamino-4-(4-pyrimidinyl)isoxazole derivative AKP-001, a potent P38 map kinase inhibitor
Ohta, Shuji,Saito, Takahisa,Kato, Jun-Ya,Sato, Shuichiro,Hayashi, Hiroyuki,Hasumi, Koichi
, p. 938 - 948 (2017/06/13)
5-Acylamino-4-(4-pyrimidinyl)isoxazole derivative AKP-001 is a p38 mitogen-activated protein kinase inhibitor previously developed in our laboratory as an anti-inflammatory agent. Herein, we report our studies leading to the development of an improved syn