36950-85-3 Usage
Main properties
1. Synthetic analog of prostaglandin F2alpha
2. Used primarily in veterinary medicine
3. Induces abortion in livestock
4. Treats conditions such as retained placenta and pyometra
5. Mimics the effects of prostaglandin F2alpha
6. Causes uterine contractions and luteolysis
7. Leads to expulsion of the fetus or treatment of reproductive disorders
8. Administered through injection or intrauterine infusion
9. Limited use in human medicine
Specific content
20-Ethyl Prostaglandin F2alpha is a synthetic analog of prostaglandin F2alpha.
It is primarily used in veterinary medicine to induce abortion in livestock.
It is also used to treat conditions such as retained placenta and pyometra in livestock.
The synthetic analog mimics the effects of prostaglandin F2alpha, including uterine contractions and luteolysis.
These effects lead to the expulsion of the fetus or treatment of reproductive disorders.
20-Et-PGF2alpha is administered either through injection or intrauterine infusion.
Its use in human medicine is limited due to potential side effects and the availability of safer alternatives.
Check Digit Verification of cas no
The CAS Registry Mumber 36950-85-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,6,9,5 and 0 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 36950-85:
(7*3)+(6*6)+(5*9)+(4*5)+(3*0)+(2*8)+(1*5)=143
143 % 10 = 3
So 36950-85-3 is a valid CAS Registry Number.
InChI:InChI=1/C22H38O5/c1-2-3-4-5-8-11-17(23)14-15-19-18(20(24)16-21(19)25)12-9-6-7-10-13-22(26)27/h6,9,14-15,17-21,23-25H,2-5,7-8,10-13,16H2,1H3,(H,26,27)/b9-6-,15-14-/t17?,18?,19-,20?,21?/m1/s1