370107-81-6 Usage
General Description
2-((1,2,4-oxadiazol-3-yl)methyl)isoindoline-1,3-dione is a chemical compound with a complex structure that includes an oxadiazole ring and an isoindoline-1,3-dione moiety. The oxadiazole ring consists of five atoms, including two nitrogen and three carbon atoms, while the isoindoline-1,3-dione moiety comprises a six-membered ring with two ketone groups. 2-((1,2,4-oxadiazol-3-yl)methyl)isoindoline-1,3-dione may have potential applications in the field of medicinal chemistry, as oxadiazole derivatives have been investigated for their antimicrobial, antifungal, and anticancer properties. Additionally, the isoindoline-1,3-dione scaffold has been utilized in the development of drugs with various pharmacological activities. However, further research is necessary to fully understand the potential uses and properties of 2-((1,2,4-oxadiazol-3-yl)methyl)isoindoline-1,3-dione.
Check Digit Verification of cas no
The CAS Registry Mumber 370107-81-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,7,0,1,0 and 7 respectively; the second part has 2 digits, 8 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 370107-81:
(8*3)+(7*7)+(6*0)+(5*1)+(4*0)+(3*7)+(2*8)+(1*1)=116
116 % 10 = 6
So 370107-81-6 is a valid CAS Registry Number.
InChI:InChI=1/C11H7N3O3/c15-10-7-3-1-2-4-8(7)11(16)14(10)5-9-12-6-17-13-9/h1-4,6H,5H2
370107-81-6Relevant articles and documents
Estra-1,3,5 (10)-triene derivatives
-
, (2008/06/13)
Provided is steroid sulfatase inhibitors comprising, as the active ingredient, an estra-1,3,5(10)-triene derivative which is represented by formula (I): {wherein R1 and R2 are the same or different and represent a hydrogen atom, a lower alkyl group or, etc.; R3 represents a hydrogen atom etc.; R4 represents a hydrogen atom etc.; R5 represents a hydrogen atom etc.; R6 represents a cyano group, an amino group, COR53 (wherein R53 represents a substituted lower alkyl group etc.), a substituted or unsubstituted aryl group, a substituted or unsubstituted heterocyclic group, etc}, or pharmaceutically acceptable salts thereof.