374537-96-9 Usage
General Description
3-Isopropylbenzeneboronic acid ethylene glycol ester is a chemical compound that consists of an isopropylbenzeneboronic acid moiety attached to an ethylene glycol ester group. 3-ISOPROPYLBENZENEBORONIC ACID ETHYLENE GLYCOL ESTER is often used as a ligand in organic synthesis and catalysis reactions. It is known for its ability to form strong bonds with various metals, making it useful in the production of pharmaceuticals, agrochemicals, and materials. Additionally, 3-isopropylbenzeneboronic acid ethylene glycol ester has potential applications in the development of new materials and as a tool in chemical research. Overall, this chemical compound has garnered interest due to its versatile properties and potential for various industrial and research applications.
Check Digit Verification of cas no
The CAS Registry Mumber 374537-96-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,7,4,5,3 and 7 respectively; the second part has 2 digits, 9 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 374537-96:
(8*3)+(7*7)+(6*4)+(5*5)+(4*3)+(3*7)+(2*9)+(1*6)=179
179 % 10 = 9
So 374537-96-9 is a valid CAS Registry Number.
InChI:InChI=1/C11H15BO2/c1-9(2)10-4-3-5-11(8-10)12-13-6-7-14-12/h3-5,8-9H,6-7H2,1-2H3