3748-77-4 Usage
Description
Bunamidine is a chemical compound with potential applications in various fields, particularly in the pharmaceutical and veterinary industries. It possesses properties that make it a promising candidate for the development of drugs targeting specific parasitic infections.
Uses
Used in Veterinary Medicine:
Bunamidine is used as an anthelmintic agent for the treatment of parasitic infections in animals. It is effective against various cestodes and trematodes, which are common parasites affecting the health of livestock and pets.
Used in Biological Studies and Pharmacological Activity:
Bunamidine is also utilized in biological research and pharmacological studies to better understand its mode of action and potential applications in therapeutic treatments. This knowledge can contribute to the development of new drugs and therapies for parasitic infections in both humans and animals.
Check Digit Verification of cas no
The CAS Registry Mumber 3748-77-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,7,4 and 8 respectively; the second part has 2 digits, 7 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 3748-77:
(6*3)+(5*7)+(4*4)+(3*8)+(2*7)+(1*7)=114
114 % 10 = 4
So 3748-77-4 is a valid CAS Registry Number.
InChI:InChI=1/C25H38N2O/c1-4-7-10-13-20-28-24-17-16-23(21-14-11-12-15-22(21)24)25(26)27(18-8-5-2)19-9-6-3/h11-12,14-17,26H,4-10,13,18-20H2,1-3H3