3786-46-7 Usage
Description
3,6-Dihydroxyphthalic acid, also known as 3,6-dihydroxy-1,4-benzenedicarboxylic acid, is an organic compound belonging to the class of dihydroxybenzenes. It is a white crystalline solid with the molecular formula C8H6O5 and is characterized by the presence of two hydroxyl groups at the 3rd and 6th positions of the phthalic acid molecule. 3,6-DIHYDROXYPHTHALIC ACID is known for its chemical reactivity and is widely utilized in various industrial applications due to its unique structural properties.
Uses
Used in Pharmaceutical Industry:
3,6-Dihydroxyphthalic acid is used as a reactant in the preparation of (±)-fredericamycin A, a potent antitumor antibiotic. It plays a crucial role in the synthesis of this therapeutic compound, which has shown significant potential in the treatment of various types of cancer. The presence of the two hydroxyl groups in the molecule allows for the formation of essential chemical bonds and interactions with other molecules during the synthesis process.
Used in Chemical Synthesis:
3,6-Dihydroxyphthalic acid is also used as a building block in the synthesis of various organic compounds, including dyes, pigments, and polymers. Its unique structure and reactivity make it a valuable intermediate in the production of a wide range of chemical products. The hydroxyl groups present in the molecule facilitate the formation of ester, ether, and other functional groups, which can be further modified to create a diverse array of compounds with specific properties and applications.
Used in Research and Development:
Due to its versatile chemical properties, 3,6-dihydroxyphthalic acid is often employed in research and development for the discovery and optimization of new chemical entities. It serves as a key starting material for the synthesis of novel compounds with potential applications in various fields, such as pharmaceuticals, materials science, and environmental chemistry. 3,6-DIHYDROXYPHTHALIC ACID's ability to form a wide range of derivatives makes it an attractive candidate for exploring new chemical reactions and developing innovative synthetic strategies.
Check Digit Verification of cas no
The CAS Registry Mumber 3786-46-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,7,8 and 6 respectively; the second part has 2 digits, 4 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 3786-46:
(6*3)+(5*7)+(4*8)+(3*6)+(2*4)+(1*6)=117
117 % 10 = 7
So 3786-46-7 is a valid CAS Registry Number.
InChI:InChI=1/C8H6O6/c9-3-1-2-4(10)6(8(13)14)5(3)7(11)12/h1-2,9-10H,(H,11,12)(H,13,14)
3786-46-7Relevant articles and documents
-
Raudnitz,Behrens
, p. 1484,1485, 1486 (1935)
-
Total Synthesis of Violaceoid A and (-)- and (+)-Violaceoid B
Murata, Takatsugu,Kuboki, Teppei,Ishikawa, Ryo,Saito, Takahiro,Taguchi, Shotaro,Takeuchi, Kazuma,Hatano, Emiko,Shimonaka, Motoyuki,Shiina, Isamu
, p. 2364 - 2370 (2018/11/23)
The first total synthesis of violaceoid A, a cytotoxic agent, and the asymmetric total synthesis of (-)- and (+)-violaceoid B are reported. The precursor was accessed by desymmetrization of a substituted quinol moiety, and the racemic secondary alcohol wa
Fluorescence emissions of imide compounds and end-capped polyimides enhanced by intramolecular double hydrogen bonds
Kanosue, Kenta,Ando, Shinji
, p. 30659 - 30669 (2015/11/23)
The structure and optical properties of a newly synthesized imide compound (DHNHPI) that forms intramolecular double hydrogen bonds (intra-HBs) were investigated. This compound exhibits intense absorption at 372 nm (Pdbl = 5091 cm-1 M-1/s
