38059-38-0 Usage
General Description
Ethanone, 1-(2,4-dimethyl-3-pyridinyl)- (9CI) is a chemical compound with the molecular formula C10H11NO. It is a derivative of pyridine, a heterocyclic aromatic compound, where a methyl group is located at the 2-position and a dimethyl group at the 4-position. Ethanone, 1-(2,4-dimethyl-3-pyridinyl)- (9CI) is commonly used in the pharmaceutical industry as a building block in the synthesis of various pharmaceutical drugs. It possesses unique chemical properties that make it useful in the development of new drugs and potentially has applications in other industrial processes. However, further research is needed to fully understand its potential uses and properties.
Check Digit Verification of cas no
The CAS Registry Mumber 38059-38-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,8,0,5 and 9 respectively; the second part has 2 digits, 3 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 38059-38:
(7*3)+(6*8)+(5*0)+(4*5)+(3*9)+(2*3)+(1*8)=130
130 % 10 = 0
So 38059-38-0 is a valid CAS Registry Number.
InChI:InChI=1/C8H9NO2/c1-5-3-4-9-6(2)7(5)8(10)11/h3-4H,1-2H3,(H,10,11)
