381248-04-0 Usage
Description
2-Chloro-3-pyridylboronic acid is an organic compound with the chemical formula C5H5BNO2Cl and is a white solid. It is a versatile reagent in organic synthesis, particularly in the formation of various biologically active molecules and pharmaceutical compounds.
Uses
Used in Pharmaceutical Industry:
2-Chloro-3-pyridylboronic acid is used as a key reactant for the synthesis of Et canthinone-3-carboxylates from Et 4-bromo-6-methoxy-1,5-naphthyridine-3-carboxylate. This synthesis involves a Pd-catalyzed Suzuki-Miyaura coupling and a Cu-catalyzed amidation reaction, which are crucial steps in the development of novel pharmaceutical compounds.
Used in Organic Synthesis:
2-Chloro-3-pyridylboronic acid is used as a building block for the preparation of arylmethylpyrrolidinylmethanols and amine derivatives. It reacts with MIDA (N-methyliminodiacetic acid) followed by a Suzuki reaction with halides or amination with amines, allowing for the creation of a diverse range of organic molecules with potential applications in various industries.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, 2-Chloro-3-pyridylboronic acid is used for the preparation of arylazabicyclooctane derivatives. These derivatives have potential as arginine vasopressin receptor antagonists, which can be utilized in the development of treatments for various medical conditions.
Used in Chemical Research:
2-Chloro-3-pyridylboronic acid is also used in the regioselective preparation of halo-oligopyridines and oligopyridines through the Suzuki-Miyaura cross-coupling reaction. This reaction is essential for the synthesis of complex molecular structures with potential applications in materials science, pharmaceuticals, and other advanced technologies.
Check Digit Verification of cas no
The CAS Registry Mumber 381248-04-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,8,1,2,4 and 8 respectively; the second part has 2 digits, 0 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 381248-04:
(8*3)+(7*8)+(6*1)+(5*2)+(4*4)+(3*8)+(2*0)+(1*4)=140
140 % 10 = 0
So 381248-04-0 is a valid CAS Registry Number.
InChI:InChI=1/C5H5BClNO2/c7-5-4(6(9)10)2-1-3-8-5/h1-3,9-10H