38183-04-9 Usage
Description
6,7-Dihydroxyflavone is a naturally occurring flavonoid compound characterized by the presence of two hydroxyl groups at the 6th and 7th positions of the flavone backbone. It is known for its diverse biological activities and potential applications in various fields due to its unique chemical structure and properties.
Uses
Used in Pharmaceutical Industry:
6,7-Dihydroxyflavone is used as a key intermediate compound for the synthesis of chromenone derivatives with biphenyl, which are valuable in the prevention or treatment of allergic diseases. Its incorporation into these derivatives enhances their anti-allergic properties, making it a significant contributor to the development of novel therapeutic agents for allergy management.
Used in Chemical Synthesis:
6,7-Dihydroxyflavone serves as a versatile building block in the synthesis of various flavonoid-based compounds with potential applications in different industries, such as pharmaceuticals, cosmetics, and agriculture. Its unique structure allows for further functionalization and modification, leading to the creation of new molecules with improved properties and enhanced biological activities.
Check Digit Verification of cas no
The CAS Registry Mumber 38183-04-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,8,1,8 and 3 respectively; the second part has 2 digits, 0 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 38183-04:
(7*3)+(6*8)+(5*1)+(4*8)+(3*3)+(2*0)+(1*4)=119
119 % 10 = 9
So 38183-04-9 is a valid CAS Registry Number.
InChI:InChI=1/C15H10O4/c16-11-7-14(9-4-2-1-3-5-9)19-15-8-13(18)12(17)6-10(11)15/h1-8,17-18H
38183-04-9Relevant articles and documents
-
, p. 115 - 123 (2019)
-
COMPOUNDS FOR IMMUNOPOTENTIATION
-
Page/Page column 118, (2010/02/15)
Methods of stimulating an immune response and treating patients responsive thereto with 3,4-di(1H-indol-3-yl)-1H-pyrrole-2,5-diones, staurosporine analogs, derivatized pyridazines, chromen-4-ones, indolinones, quinazolines, nucleoside analogs, and other small molecules are disclosed.
