38284-44-5 Usage
General Description
2-(bicyclo[2.2.1]hept-5-en-2-ylmethylene)hexenal is a chemical compound with the molecular formula C13H18O. It is an aldehyde and is derived from the bicyclo[2.2.1]hept-5-en-2-ylmethylene group. 2-(bicyclo[2.2.1]hept-5-en-2-ylmethylene)hexenal is used in the synthesis of organic molecules and may have potential applications in the pharmaceutical or chemical industries. However, due to its complex structure and potential reactivity, it requires careful handling and storage. Its precise properties and uses may vary depending on the specific application and context in which it is used.
Check Digit Verification of cas no
The CAS Registry Mumber 38284-44-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,8,2,8 and 4 respectively; the second part has 2 digits, 4 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 38284-44:
(7*3)+(6*8)+(5*2)+(4*8)+(3*4)+(2*4)+(1*4)=135
135 % 10 = 5
So 38284-44-5 is a valid CAS Registry Number.
InChI:InChI=1/C14H20O/c1-2-3-4-12(10-15)9-14-8-11-5-6-13(14)7-11/h5-6,9-11,13-14H,2-4,7-8H2,1H3