3832-87-9 Usage
Type of compound
naphthalene derivative with a fluorine substituent
Classification
acetonitrile (organic nitrile)
Uses
chemical intermediate in the synthesis of various compounds (e.g. pharmaceuticals, agrochemicals)
Properties influenced by fluorine atom
potential specific chemical and physical properties
Evaluation needed
comprehensive analysis and understanding of properties and potential reactions to determine precise uses and potential hazards.
Check Digit Verification of cas no
The CAS Registry Mumber 3832-87-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,8,3 and 2 respectively; the second part has 2 digits, 8 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 3832-87:
(6*3)+(5*8)+(4*3)+(3*2)+(2*8)+(1*7)=99
99 % 10 = 9
So 3832-87-9 is a valid CAS Registry Number.
InChI:InChI=1/C12H8FN/c13-12-6-5-9(7-8-14)10-3-1-2-4-11(10)12/h1-6H,7H2