38479-34-4 Usage
General Description
1,4-Cyclohexanediol dimethacrylate is a chemical compound that is commonly used in the production of polymer materials. It is a diacrylate ester, meaning it contains two acrylate groups. 1,4-Cyclohexanediol dimethacrylate is often employed as a crosslinking agent in the synthesis of polymers, such as dental composites and adhesives. With its high reactivity and ability to form strong covalent bonds, 1,4-Cyclohexanediol dimethacrylate helps to improve the mechanical and thermal properties of polymers, making them more durable and resistant to degradation. Additionally, this compound has been found to have potential applications in the fields of biomaterials and tissue engineering due to its biocompatibility and ability to support cell attachment and growth. Overall, 1,4-Cyclohexanediol dimethacrylate plays a crucial role in the development of advanced polymer materials with enhanced performance characteristics.
Check Digit Verification of cas no
The CAS Registry Mumber 38479-34-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,8,4,7 and 9 respectively; the second part has 2 digits, 3 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 38479-34:
(7*3)+(6*8)+(5*4)+(4*7)+(3*9)+(2*3)+(1*4)=154
154 % 10 = 4
So 38479-34-4 is a valid CAS Registry Number.
InChI:InChI=1/C14H20O4/c1-9(2)13(15)17-11-5-7-12(8-6-11)18-14(16)10(3)4/h11-12H,1,3,5-8H2,2,4H3
