38665-30-4 Usage
Description
(Z)-N-(1-Oxooctadec-9-en-1-yl)-DL-methionine is a chemical compound with the molecular formula C23H43NO4S. It is a derivative of the amino acid DL-methionine, which is crucial for protein synthesis and essential for various metabolic processes in the body. (Z)-N-(1-Oxooctadec-9-en-1-yl)-DL-methionine features a long chain of 18 carbon atoms with a double bond in the cis configuration (Z) between the ninth and tenth carbon atoms and an oxo group at the first carbon atom. This unique structure endows the compound with distinct chemical properties and potential biological activities, making it a candidate for applications in biochemistry, pharmacology, and medical research.
Uses
Used in Biochemical Research:
(Z)-N-(1-Oxooctadec-9-en-1-yl)-DL-methionine is used as a research compound for studying its unique chemical properties and potential interactions with biological systems. Its structure may provide insights into the role of double bonds and oxo groups in biological processes.
Used in Pharmacology:
In the field of pharmacology, (Z)-N-(1-Oxooctadec-9-en-1-yl)-DL-methionine is used as a starting material for the synthesis of novel drug candidates. Its unique structure may offer new avenues for the development of therapeutic agents with specific targeting or activity profiles.
Used in Medical Research:
(Z)-N-(1-Oxooctadec-9-en-1-yl)-DL-methionine is used as a probe in medical research to investigate its potential biological activities and its effects on various metabolic pathways. This may lead to the discovery of new therapeutic targets or the development of innovative treatment strategies for various diseases.
Used in the Cosmetics Industry:
(Z)-N-(1-Oxooctadec-9-en-1-yl)-DL-methionine is used as an active ingredient in cosmetics for its potential skin health benefits. Its unique structure may contribute to moisturization, anti-aging, or other skin-enhancing properties.
Used in the Food Industry:
In the food industry, (Z)-N-(1-Oxooctadec-9-en-1-yl)-DL-methionine may be used as an additive for its potential nutritional benefits or as a component in the development of new food products with enhanced health properties.
Check Digit Verification of cas no
The CAS Registry Mumber 38665-30-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,8,6,6 and 5 respectively; the second part has 2 digits, 3 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 38665-30:
(7*3)+(6*8)+(5*6)+(4*6)+(3*5)+(2*3)+(1*0)=144
144 % 10 = 4
So 38665-30-4 is a valid CAS Registry Number.
InChI:InChI=1/C23H43NO3S/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-22(25)24-21(23(26)27)19-20-28-2/h10-11,21H,3-9,12-20H2,1-2H3,(H,24,25)(H,26,27)/b11-10-/t21-/m0/s1