38932-40-0 Usage
Description
Sodium [6R-[6alpha,7beta(R)]]-7-(aminophenylacetamido)-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate is a complex organic compound with a unique chemical structure. It is characterized by its molecular arrangement and the presence of various functional groups, such as the aminophenylacetamido and carboxylate moieties. sodium [6R-[6alpha,7beta(R)]]-7-(aminophenylacetamido)-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate has potential applications in various fields due to its chemical properties and reactivity.
Uses
Used in Pharmaceutical Industry:
Sodium [6R-[6alpha,7beta(R)]]-7-(aminophenylacetamido)-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate is used as an active pharmaceutical ingredient (API) for the development of new drugs. Its unique structure and functional groups make it a promising candidate for targeting specific biological pathways and receptors, potentially leading to the creation of novel therapeutic agents.
Used in Chemical Research:
sodium [6R-[6alpha,7beta(R)]]-7-(aminophenylacetamido)-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate is also used as a research tool in the field of organic chemistry. Its synthesis and reactivity can provide valuable insights into the development of new synthetic methods, as well as the study of various chemical reactions and mechanisms.
Used in Material Science:
Due to its structural complexity and potential for functionalization, sodium [6R-[6alpha,7beta(R)]]-7-(aminophenylacetamido)-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate may find applications in the development of new materials with specific properties, such as improved mechanical strength, thermal stability, or chemical resistance.
Check Digit Verification of cas no
The CAS Registry Mumber 38932-40-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,8,9,3 and 2 respectively; the second part has 2 digits, 4 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 38932-40:
(7*3)+(6*8)+(5*9)+(4*3)+(3*2)+(2*4)+(1*0)=140
140 % 10 = 0
So 38932-40-0 is a valid CAS Registry Number.
InChI:InChI=1/C16H17N3O4S.Na/c1-8-7-24-15-11(14(21)19(15)12(8)16(22)23)18-13(20)10(17)9-5-3-2-4-6-9;/h2-6,10-11,15H,7,17H2,1H3,(H,18,20)(H,22,23);/q;+1/p-1