394655-14-2 Usage
General Description
2,4-DIOXO-4-PYRIDIN-3-YLBUTANOIC ACID, also known as 3-Pyridylacetic acid, is a chemical compound with the molecular formula C9H7NO4. It is a pyridine derivative with a carboxylic acid group and a ketone group, and it is commonly used in the synthesis of pharmaceuticals and agricultural chemicals. 2,4-DIOXO-4-PYRIDIN-3-YLBUTANOIC ACID is known for its potential anti-inflammatory and antifungal properties, and it is used in the production of various drugs and pesticides. It is also a key intermediate in the synthesis of other organic compounds, and its versatile chemical structure makes it valuable in the field of medicinal chemistry and chemical research.
Check Digit Verification of cas no
The CAS Registry Mumber 394655-14-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,9,4,6,5 and 5 respectively; the second part has 2 digits, 1 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 394655-14:
(8*3)+(7*9)+(6*4)+(5*6)+(4*5)+(3*5)+(2*1)+(1*4)=182
182 % 10 = 2
So 394655-14-2 is a valid CAS Registry Number.
InChI:InChI=1/C9H7NO4/c11-7(4-8(12)9(13)14)6-2-1-3-10-5-6/h1-3,5H,4H2,(H,13,14)