3973-70-4 Usage
Description
1-AMINO-4-(2-HYDROXYETHYL)PIPERAZINE, also known as AEP, is an organic compound that plays a crucial role in the synthesis of dendrimers, which are highly branched and precisely defined macromolecules. AEP undergoes a Schiff's reaction with phosphorus-containing dendrimers, resulting in dendrimers with up to 48 alcohol chain ends. These dendrimers have potential applications in various fields due to their unique structure and properties.
Uses
Used in Pharmaceutical Industry:
1-AMINO-4-(2-HYDROXYETHYL)PIPERAZINE is used as a building block for the synthesis of dendrimers for drug delivery applications. The dendrimers synthesized using AEP can enhance the solubility, stability, and bioavailability of drugs, leading to improved therapeutic outcomes.
Used in Material Science:
1-AMINO-4-(2-HYDROXYETHYL)PIPERAZINE is used as a key component in the development of dendrimers for various material science applications. These dendrimers can be utilized in the creation of advanced materials with tailored properties, such as high-performance polymers, sensors, and catalysts.
Used in Nanotechnology:
1-AMINO-4-(2-HYDROXYETHYL)PIPERAZINE is used as a precursor in the synthesis of dendrimers for nanotechnology applications. The unique structure of these dendrimers allows for their use in the development of nanoscale devices, such as drug delivery systems, imaging agents, and targeted therapeutics.
Check Digit Verification of cas no
The CAS Registry Mumber 3973-70-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,9,7 and 3 respectively; the second part has 2 digits, 7 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 3973-70:
(6*3)+(5*9)+(4*7)+(3*3)+(2*7)+(1*0)=114
114 % 10 = 4
So 3973-70-4 is a valid CAS Registry Number.
InChI:InChI=1/C6H17N3O/c7-9-3-1-8(2-4-9)5-6-10/h9-10H,1-6H2,7H3/q+2/p+1