39833-65-3 Usage
Description
1-(chloromethyl)-3-vinylbenzene, also known as 3-(chloromethyl)styrene, is an olefin-based monomer with a molecular structure that features a chlorine atom attached to the methyl group and a vinyl group on the benzene ring. 1-(chloromethyl)-3-vinylbenzene is characterized by its good tensile strength and is a key component in the production of various polymers.
Uses
1. Used in Polymer Industry:
1-(chloromethyl)-3-vinylbenzene is used as a monomer for the production of polyolefin compounds. Its application is primarily due to its good tensile strength, which contributes to the overall strength and durability of the resulting polymers. The use of hybrid metallocene catalysts in the manufacturing process further enhances the properties of the polyolefin compounds, making them suitable for a wide range of applications, including packaging materials, automotive components, and consumer goods.
2. Used in Chemical Synthesis:
1-(chloromethyl)-3-vinylbenzene can also be utilized as an intermediate in the synthesis of various chemicals and pharmaceuticals. Its unique structure allows for further functionalization and modification, making it a versatile building block for the development of new compounds with specific properties and applications.
3. Used in Adhesives and Coatings:
Due to its strong bonding capabilities and chemical stability, 1-(chloromethyl)-3-vinylbenzene can be employed in the formulation of adhesives and coatings. It can improve the adhesion properties and durability of these products, making them suitable for use in various industries, such as construction, automotive, and electronics.
4. Used in Research and Development:
As a chemical intermediate, 1-(chloromethyl)-3-vinylbenzene is also valuable in research and development for the creation of new materials and compounds. Its unique structure and properties make it an interesting candidate for exploring novel applications and advancements in various fields, including materials science, pharmaceuticals, and chemical engineering.
Check Digit Verification of cas no
The CAS Registry Mumber 39833-65-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,9,8,3 and 3 respectively; the second part has 2 digits, 6 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 39833-65:
(7*3)+(6*9)+(5*8)+(4*3)+(3*3)+(2*6)+(1*5)=153
153 % 10 = 3
So 39833-65-3 is a valid CAS Registry Number.
InChI:InChI=1/C9H9Cl/c1-2-8-4-3-5-9(6-8)7-10/h2-6H,1,7H2
39833-65-3Relevant articles and documents
AZABICYCLIC COMPOUNDS, PHARMACEUTICAL COMPOSITIONS CONTAINING THEM AND THEIR USE IN THERAPY
-
, (2008/06/13)
Compounds of formula (I), and salts and prodrugs thereof STR1 wherein Q is the residue of an optionally substituted azabicyclic ring system;X represents oxa or thia;Y represents H or hydroxy;R 1 and R. sup.2 independently represent phenyl or thienyl, either of which groups may be optionally substituted by halo or trifluoromethyl;R 3, R 4 and R 5 independently represent H, C 1-6 alkyl, C 2-6 alkenyl, C 2-6 alkynyl, halo, cyano, nitro, trifluoromethyl, trimethylsilyl,--OR a, SCH 3, SOCH 3, SO. sub.2 CH 3,--NR a R b,--NR a COR b,--NR a CO. sub.2 R b,--CO. sub.2 R a or--CONR a R b ;R a and R. sup.b independently represent H, C 1-6 alkyl, phenyl or trifluoromethyl, are tachykinin antagonists. They and compositions thereof are therefore useful in therapy.