4005-35-0 Usage
Description
3-Deoxy-D-galactose, also known as 3-deoxy-D-galactopyranose, is a monosaccharide derived from the sugar family. It is characterized by the absence of an oxygen atom at the third carbon position, which distinguishes it from other sugars in the D-galactose group. This unique structural feature endows 3-Deoxy-D-galactose with specific properties and potential applications in various fields.
Uses
Used in Enzyme Research:
3-Deoxy-D-galactose is used as a substrate to examine the substrate specificity of galactokinase enzymes, particularly from Streptomyces coelicolor. This application is crucial for understanding the enzyme's function and its role in the metabolism of sugars, which can have implications in various biological processes and potential therapeutic applications.
Check Digit Verification of cas no
The CAS Registry Mumber 4005-35-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,0,0 and 5 respectively; the second part has 2 digits, 3 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 4005-35:
(6*4)+(5*0)+(4*0)+(3*5)+(2*3)+(1*5)=50
50 % 10 = 0
So 4005-35-0 is a valid CAS Registry Number.
InChI:InChI=1/C6H14O5/c7-2-4(9)1-5(10)6(11)3-8/h4-11H,1-3H2/t4-,5-,6-/m1/s1
